C21H26Cl2N6O — CID 146482796
(3S,4S)-8-[5-(2,3-dichlorophenyl)-6-imino-1-methanimidoyl-4-methylpyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine (PubChem CID 146482796) has the molecular formula C21H26Cl2N6O and a molecular weight of 449.39 g/mol. Its IUPAC name is (3S,4S)-8-[5-(2,3-dichlorophenyl)-6-imino-1-methanimidoyl-4-methylpyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (3S,4S)-8-[5-(2,3-dichlorophenyl)-6-imino-1-methanimidoyl-4-methylpyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 146482796 |
| Molecular Formula | C21H26Cl2N6O |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (3S,4S)-8-[5-(2,3-dichlorophenyl)-6-imino-1-methanimidoyl-4-methylpyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
| SMILES | [H]/N=c1/c(-c2cccc(Cl)c2Cl)c(C)nc(N2CCC3(CC2)CO[C@@H](C)[C@H]3N)n1/C=N/[H] |
| InChI | InChI=1S/C21H26Cl2N6O/c1-12-16(14-4-3-5-15(22)17(14)23)19(26)29(11-24)20(27-12)28-8-6-21(7-9-28)10-30-13(2)18(21)25/h3-5,11,13,18,24,26H,6-10,25H2,1-2H3/b24-11+,26-19-/t13-,18+/m0/s1 |
| InChIKey | GTTOUPFPAJJBDU-YTCUUUCRSA-N |
| XLogP | 3.43 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|