C20H24Cl2N6S — CID 139427669
(4R)-8-[5-(2,3-dichlorophenyl)sulfanyl-6-imino-1-methanimidoylpyrimidin-2-yl]-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427669) has the molecular formula C20H24Cl2N6S and a molecular weight of 451.43 g/mol. Its IUPAC name is (4R)-8-[5-(2,3-dichlorophenyl)sulfanyl-6-imino-1-methanimidoylpyrimidin-2-yl]-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4R)-8-[5-(2,3-dichlorophenyl)sulfanyl-6-imino-1-methanimidoylpyrimidin-2-yl]-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427669 |
| Molecular Formula | C20H24Cl2N6S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (4R)-8-[5-(2,3-dichlorophenyl)sulfanyl-6-imino-1-methanimidoylpyrimidin-2-yl]-8-azaspiro[4.5]decan-4-amine |
| SMILES | [H]/N=C/n1c(N2CCC3(CCC[C@H]3N)CC2)ncc(Sc2cccc(Cl)c2Cl)/c1=N\[H] |
| InChI | InChI=1S/C20H24Cl2N6S/c21-13-3-1-4-14(17(13)22)29-15-11-26-19(28(12-23)18(15)25)27-9-7-20(8-10-27)6-2-5-16(20)24/h1,3-4,11-12,16,23,25H,2,5-10,24H2/b23-12+,25-18+/t16-/m1/s1 |
| InChIKey | AZCJQUISUBAIAM-LJSNVXIUSA-N |
| XLogP | 4.37 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|