C23H30FN3O6 — CID 146483162
tert-butyl 4-[2-(2-fluoro-3-hydroxy-3-methylbutyl)-6-nitro-3-oxo-1H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 146483162) has the molecular formula C23H30FN3O6 and a molecular weight of 463.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-fluoro-3-hydroxy-3-methylbutyl)-6-nitro-3-oxo-1H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-fluoro-3-hydroxy-3-methylbutyl)-6-nitro-3-oxo-1H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 146483162 |
| Molecular Formula | C23H30FN3O6 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl 4-[2-(2-fluoro-3-hydroxy-3-methylbutyl)-6-nitro-3-oxo-1H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cc3c(cc2[N+](=O)[O-])CN(CC(F)C(C)(C)O)C3=O)CC1 |
| InChI | InChI=1S/C23H30FN3O6/c1-22(2,3)33-21(29)25-8-6-14(7-9-25)16-11-17-15(10-18(16)27(31)32)12-26(20(17)28)13-19(24)23(4,5)30/h6,10-11,19,30H,7-9,12-13H2,1-5H3 |
| InChIKey | UGCXRFWOQWGSOM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|