C23H23Cl3N2O4 — CID 146484382
[3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methylcarbamic acid (PubChem CID 146484382) has the molecular formula C23H23Cl3N2O4 and a molecular weight of 497.81 g/mol. Its IUPAC name is [3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methylcarbamic acid.
| Compound Name | [3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 146484382 |
| Molecular Formula | C23H23Cl3N2O4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | [3-[4-[2-[3,5-dichloro-4-(3-chloropropoxy)phenyl]propan-2-yl]phenyl]-1,2-oxazol-5-yl]methylcarbamic acid |
| SMILES | CC(C)(c1ccc(-c2cc(CNC(=O)O)on2)cc1)c1cc(Cl)c(OCCCCl)c(Cl)c1 |
| InChI | InChI=1S/C23H23Cl3N2O4/c1-23(2,16-10-18(25)21(19(26)11-16)31-9-3-8-24)15-6-4-14(5-7-15)20-12-17(32-28-20)13-27-22(29)30/h4-7,10-12,27H,3,8-9,13H2,1-2H3,(H,29,30) |
| InChIKey | BXIVGWTWADMOSZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|