C10H14F3N3O — CID 146485613
2-piperidin-4-yl-5-(1,2,2-trifluoroethyl)-1H-pyrazol-3-one (PubChem CID 146485613) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-piperidin-4-yl-5-(1,2,2-trifluoroethyl)-1H-pyrazol-3-one.
| Compound Name | 2-piperidin-4-yl-5-(1,2,2-trifluoroethyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 146485613 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-piperidin-4-yl-5-(1,2,2-trifluoroethyl)-1H-pyrazol-3-one |
| SMILES | O=c1cc(C(F)C(F)F)[nH]n1C1CCNCC1 |
| InChI | InChI=1S/C10H14F3N3O/c11-9(10(12)13)7-5-8(17)16(15-7)6-1-3-14-4-2-6/h5-6,9-10,14-15H,1-4H2 |
| InChIKey | JOFLBVAUIOJCBW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |