About 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid
2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid (PubChem CID 146486649) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid.
Molecular Properties
| Compound Name | 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid |
| PubChem CID | 146486649 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid |
| SMILES | CC1(C)CCC(c2ccc(C(=O)O)c(N)c2)CC1 |
| InChI | InChI=1S/C15H21NO2/c1-15(2)7-5-10(6-8-15)11-3-4-12(14(17)18)13(16)9-11/h3-4,9-10H,5-8,16H2,1-2H3,(H,17,18) |
| InChIKey | QAFUOYHGIMFOLC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid?
The IUPAC name of 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid (CID 146486649) is 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid.
What is the SMILES notation for 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid?
The canonical SMILES for 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid is CC1(C)CCC(c2ccc(C(=O)O)c(N)c2)CC1.
What is the InChIKey of 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid?
The InChIKey is QAFUOYHGIMFOLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-15(2)7-5-10(6-8-15)11-3-4-12(14(17)18)13(16)9-11/h3-4,9-10H,5-8,16H2,1-2H3,(H,17,18).
What are the key properties of 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid?
2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid has a molecular weight of 247.34 g/mol, XLogP of 3.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4,4-dimethylcyclohexyl)benzoic acid is sourced from PubChem (CID 146486649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).