C27H18ClN3O — CID 146489534
(4R)-2-chloro-4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 146489534) has the molecular formula C27H18ClN3O and a molecular weight of 435.91 g/mol. Its IUPAC name is (4R)-2-chloro-4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | (4R)-2-chloro-4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 146489534 |
| Molecular Formula | C27H18ClN3O |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (4R)-2-chloro-4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | ClC1=N[C@H](c2cccc(-c3cccc4c3oc3ccccc34)c2)N=C(c2ccccc2)N1 |
| InChI | InChI=1S/C27H18ClN3O/c28-27-30-25(17-8-2-1-3-9-17)29-26(31-27)19-11-6-10-18(16-19)20-13-7-14-22-21-12-4-5-15-23(21)32-24(20)22/h1-16,26H,(H,29,30,31)/t26-/m1/s1 |
| InChIKey | LQMXVGSJMCYGIJ-AREMUKBSSA-N |
| XLogP | 6.90 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|