C21H14ClN3O — CID 118888315
2-chloro-6-dibenzofuran-1-yl-4-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 118888315) has the molecular formula C21H14ClN3O and a molecular weight of 359.82 g/mol. Its IUPAC name is 2-chloro-6-dibenzofuran-1-yl-4-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-chloro-6-dibenzofuran-1-yl-4-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 118888315 |
| Molecular Formula | C21H14ClN3O |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-chloro-6-dibenzofuran-1-yl-4-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | ClC1=NC(c2ccccc2)N=C(c2cccc3oc4ccccc4c23)N1 |
| InChI | InChI=1S/C21H14ClN3O/c22-21-24-19(13-7-2-1-3-8-13)23-20(25-21)15-10-6-12-17-18(15)14-9-4-5-11-16(14)26-17/h1-12,19H,(H,23,24,25) |
| InChIKey | VWLZZRCWHDHZHB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|