C17H19ClN6O — CID 146489767
N-[2-[2-(3-azabicyclo[4.1.0]heptan-3-yl)pyrimidin-5-yl]pyrimidin-4-yl]-2-chloropropanamide (PubChem CID 146489767) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[2-[2-(3-azabicyclo[4.1.0]heptan-3-yl)pyrimidin-5-yl]pyrimidin-4-yl]-2-chloropropanamide.
| Compound Name | N-[2-[2-(3-azabicyclo[4.1.0]heptan-3-yl)pyrimidin-5-yl]pyrimidin-4-yl]-2-chloropropanamide |
|---|---|
| PubChem CID | 146489767 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-[2-(3-azabicyclo[4.1.0]heptan-3-yl)pyrimidin-5-yl]pyrimidin-4-yl]-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)Nc1ccnc(-c2cnc(N3CCC4CC4C3)nc2)n1 |
| InChI | InChI=1S/C17H19ClN6O/c1-10(18)16(25)23-14-2-4-19-15(22-14)13-7-20-17(21-8-13)24-5-3-11-6-12(11)9-24/h2,4,7-8,10-12H,3,5-6,9H2,1H3,(H,19,22,23,25) |
| InChIKey | LDEHGWXRUSUOPB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|