C24H32ClN5O — CID 57465531
2-(4-chlorophenyl)-N-[2-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-3-methylbutanamide (PubChem CID 57465531) has the molecular formula C24H32ClN5O and a molecular weight of 442.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-3-methylbutanamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 57465531 |
| Molecular Formula | C24H32ClN5O |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1ccnc(N2CCN(C3CCCC3)CC2)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN5O/c1-17(2)22(18-7-9-19(25)10-8-18)23(31)27-21-11-12-26-24(28-21)30-15-13-29(14-16-30)20-5-3-4-6-20/h7-12,17,20,22H,3-6,13-16H2,1-2H3,(H,26,27,28,31) |
| InChIKey | NDQXYFGSSMBJBN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |