C25H23F2N7 — CID 146490889
2-[(3E,5Z)-3-fluoro-2-methylidenehepta-3,5-dienyl]-7-(4-fluorophenyl)-8-[2-(methylamino)-4-pyridinyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 146490889) has the molecular formula C25H23F2N7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[(3E,5Z)-3-fluoro-2-methylidenehepta-3,5-dienyl]-7-(4-fluorophenyl)-8-[2-(methylamino)-4-pyridinyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 2-[(3E,5Z)-3-fluoro-2-methylidenehepta-3,5-dienyl]-7-(4-fluorophenyl)-8-[2-(methylamino)-4-pyridinyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 146490889 |
| Molecular Formula | C25H23F2N7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[(3E,5Z)-3-fluoro-2-methylidenehepta-3,5-dienyl]-7-(4-fluorophenyl)-8-[2-(methylamino)-4-pyridinyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | C=C(Cc1nc2c(-c3ccnc(NC)c3)c(-c3ccc(F)cc3)nc(N)n2n1)/C(F)=C\C=C/C |
| InChI | InChI=1S/C25H23F2N7/c1-4-5-6-19(27)15(2)13-21-31-24-22(17-11-12-30-20(14-17)29-3)23(32-25(28)34(24)33-21)16-7-9-18(26)10-8-16/h4-12,14H,2,13H2,1,3H3,(H2,28,32)(H,29,30)/b5-4-,19-6+ |
| InChIKey | QTDZZNXWZWCNQP-KYCOTQASSA-N |
| XLogP | 5.14 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|