C6H9N3 — CID 146491771
N-(1,4-dimethylpyrazol-5-yl)methanimine (PubChem CID 146491771) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is N-(1,4-dimethylpyrazol-5-yl)methanimine.
| Compound Name | N-(1,4-dimethylpyrazol-5-yl)methanimine |
|---|---|
| PubChem CID | 146491771 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | N-(1,4-dimethylpyrazol-5-yl)methanimine |
| SMILES | C=Nc1c(C)cnn1C |
| InChI | InChI=1S/C6H9N3/c1-5-4-8-9(3)6(5)7-2/h4H,2H2,1,3H3 |
| InChIKey | NZPLAPWGMDXEHC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|