C29H38O11 — CID 146491847
2-[[6-[(Z)-but-2-enoyl]oxy-2-hydroxy-3-methylhexanoyl]oxymethyl]-1-methyl-11-prop-2-enoyloxyspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-5-carboxylic acid (PubChem CID 146491847) has the molecular formula C29H38O11 and a molecular weight of 562.61 g/mol. Its IUPAC name is 2-[[6-[(Z)-but-2-enoyl]oxy-2-hydroxy-3-methylhexanoyl]oxymethyl]-1-methyl-11-prop-2-enoyloxyspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-5-carboxylic acid.
| Compound Name | 2-[[6-[(Z)-but-2-enoyl]oxy-2-hydroxy-3-methylhexanoyl]oxymethyl]-1-methyl-11-prop-2-enoyloxyspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-5-carboxylic acid |
|---|---|
| PubChem CID | 146491847 |
| Molecular Formula | C29H38O11 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 2-[[6-[(Z)-but-2-enoyl]oxy-2-hydroxy-3-methylhexanoyl]oxymethyl]-1-methyl-11-prop-2-enoyloxyspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-5-carboxylic acid |
| SMILES | C=CC(=O)OC1CC2OC3C=C(C(=O)O)CCC3(COC(=O)C(O)C(C)CCCOC(=O)/C=C\C)C1(C)C21CO1 |
| InChI | InChI=1S/C29H38O11/c1-5-8-23(31)36-12-7-9-17(3)24(32)26(35)37-15-28-11-10-18(25(33)34)13-20(28)39-21-14-19(40-22(30)6-2)27(28,4)29(21)16-38-29/h5-6,8,13,17,19-21,24,32H,2,7,9-12,14-16H2,1,3-4H3,(H,33,34)/b8-5- |
| InChIKey | RSHIWRBAIJFZRH-YVMONPNESA-N |
| XLogP | 2.26 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|