C10H14N2O2 — CID 146496132
ethyl 4-amino-3-ethenyl-1-methylpyrrole-2-carboxylate (PubChem CID 146496132) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is ethyl 4-amino-3-ethenyl-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-amino-3-ethenyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 146496132 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethyl 4-amino-3-ethenyl-1-methylpyrrole-2-carboxylate |
| SMILES | C=Cc1c(N)cn(C)c1C(=O)OCC |
| InChI | InChI=1S/C10H14N2O2/c1-4-7-8(11)6-12(3)9(7)10(13)14-5-2/h4,6H,1,5,11H2,2-3H3 |
| InChIKey | LYJCPWUEFSDZMF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |