C10H10FNO5 — CID 121409825
2-(5-ethoxycarbonyl-4-fluoro-1-methylpyrrol-3-yl)-2-oxoacetic acid (PubChem CID 121409825) has the molecular formula C10H10FNO5 and a molecular weight of 243.19 g/mol. Its IUPAC name is 2-(5-ethoxycarbonyl-4-fluoro-1-methylpyrrol-3-yl)-2-oxoacetic acid.
| Compound Name | 2-(5-ethoxycarbonyl-4-fluoro-1-methylpyrrol-3-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 121409825 |
| Molecular Formula | C10H10FNO5 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(5-ethoxycarbonyl-4-fluoro-1-methylpyrrol-3-yl)-2-oxoacetic acid |
| SMILES | CCOC(=O)c1c(F)c(C(=O)C(=O)O)cn1C |
| InChI | InChI=1S/C10H10FNO5/c1-3-17-10(16)7-6(11)5(4-12(7)2)8(13)9(14)15/h4H,3H2,1-2H3,(H,14,15) |
| InChIKey | HAFDADYDISJMLF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|