C18H20ClFN6O2S — CID 146496310
2-chloro-N-(2-cyano-6-fluoro-4-pyridinyl)-1-[(1-hydroxypropan-2-ylamino)sulfanylamino]-5,6,7,8-tetrahydroindolizine-3-carboxamide (PubChem CID 146496310) has the molecular formula C18H20ClFN6O2S and a molecular weight of 438.92 g/mol. Its IUPAC name is 2-chloro-N-(2-cyano-6-fluoro-4-pyridinyl)-1-[(1-hydroxypropan-2-ylamino)sulfanylamino]-5,6,7,8-tetrahydroindolizine-3-carboxamide.
| Compound Name | 2-chloro-N-(2-cyano-6-fluoro-4-pyridinyl)-1-[(1-hydroxypropan-2-ylamino)sulfanylamino]-5,6,7,8-tetrahydroindolizine-3-carboxamide |
|---|---|
| PubChem CID | 146496310 |
| Molecular Formula | C18H20ClFN6O2S |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-chloro-N-(2-cyano-6-fluoro-4-pyridinyl)-1-[(1-hydroxypropan-2-ylamino)sulfanylamino]-5,6,7,8-tetrahydroindolizine-3-carboxamide |
| SMILES | CC(CO)NSNc1c(Cl)c(C(=O)Nc2cc(F)nc(C#N)c2)n2c1CCCC2 |
| InChI | InChI=1S/C18H20ClFN6O2S/c1-10(9-27)24-29-25-16-13-4-2-3-5-26(13)17(15(16)19)18(28)23-11-6-12(8-21)22-14(20)7-11/h6-7,10,24-25,27H,2-5,9H2,1H3,(H,22,23,28) |
| InChIKey | RUWWUUBTGKFORK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|