C19H21NO — CID 146498040
(8R)-9-benzyl-9-azatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-ol (PubChem CID 146498040) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (8R)-9-benzyl-9-azatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-ol.
| Compound Name | (8R)-9-benzyl-9-azatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-ol |
|---|---|
| PubChem CID | 146498040 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (8R)-9-benzyl-9-azatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-ol |
| SMILES | Oc1ccc2c(c1)[C@H]1CC2CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO/c21-16-8-9-17-15-7-4-10-20(19(11-15)18(17)12-16)13-14-5-2-1-3-6-14/h1-3,5-6,8-9,12,15,19,21H,4,7,10-11,13H2/t15?,19-/m1/s1 |
| InChIKey | FRJWWNRFFVLGNV-XCWJXAQQSA-N |
| XLogP | 4.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |