C17H18N4O3S — CID 146501048
1-(4-methylphenyl)sulfonyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrole-3-carboxamide (PubChem CID 146501048) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146501048 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]pyrrole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(C(=O)NCc3cc(C)[nH]n3)c2)cc1 |
| InChI | InChI=1S/C17H18N4O3S/c1-12-3-5-16(6-4-12)25(23,24)21-8-7-14(11-21)17(22)18-10-15-9-13(2)19-20-15/h3-9,11H,10H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | MMIGNIWFFSAIQV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |