C17H20N2O5S — CID 119199273
2-methyl-2-[[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]butanoic acid (PubChem CID 119199273) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-methyl-2-[[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]butanoic acid.
| Compound Name | 2-methyl-2-[[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119199273 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-methyl-2-[[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]butanoic acid |
| SMILES | CCC(C)(NC(=O)c1ccn(S(=O)(=O)c2ccc(C)cc2)c1)C(=O)O |
| InChI | InChI=1S/C17H20N2O5S/c1-4-17(3,16(21)22)18-15(20)13-9-10-19(11-13)25(23,24)14-7-5-12(2)6-8-14/h5-11H,4H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | UEDCKNLIPGPNMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |