C17H20N2O5S — CID 119191230
3-[ethyl-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]propanoic acid (PubChem CID 119191230) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-[ethyl-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119191230 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[ethyl-[1-(4-methylphenyl)sulfonylpyrrole-3-carbonyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)c1ccn(S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-3-18(10-9-16(20)21)17(22)14-8-11-19(12-14)25(23,24)15-6-4-13(2)5-7-15/h4-8,11-12H,3,9-10H2,1-2H3,(H,20,21) |
| InChIKey | GMTTVGYGZWUSQN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |