C33H27F4N3O3 — CID 146506675
4-[1-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(6-methoxynaphthalen-2-yl)pyrazol-1-yl]ethyl]-N-(3-oxopropyl)benzamide (PubChem CID 146506675) has the molecular formula C33H27F4N3O3 and a molecular weight of 589.59 g/mol. Its IUPAC name is 4-[1-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(6-methoxynaphthalen-2-yl)pyrazol-1-yl]ethyl]-N-(3-oxopropyl)benzamide.
| Compound Name | 4-[1-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(6-methoxynaphthalen-2-yl)pyrazol-1-yl]ethyl]-N-(3-oxopropyl)benzamide |
|---|---|
| PubChem CID | 146506675 |
| Molecular Formula | C33H27F4N3O3 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | 4-[1-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-5-(6-methoxynaphthalen-2-yl)pyrazol-1-yl]ethyl]-N-(3-oxopropyl)benzamide |
| SMILES | COc1ccc2cc(-c3cc(-c4cc(C(F)(F)F)ccc4F)nn3C(C)c3ccc(C(=O)NCCC=O)cc3)ccc2c1 |
| InChI | InChI=1S/C33H27F4N3O3/c1-20(21-4-6-22(7-5-21)32(42)38-14-3-15-41)40-31(25-9-8-24-17-27(43-2)12-10-23(24)16-25)19-30(39-40)28-18-26(33(35,36)37)11-13-29(28)34/h4-13,15-20H,3,14H2,1-2H3,(H,38,42) |
| InChIKey | FZNATGHUSXOHFN-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|