C13H26N2O — CID 146507365
(4aS,8aS)-6-[(2S)-hexan-2-yl]-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine (PubChem CID 146507365) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (4aS,8aS)-6-[(2S)-hexan-2-yl]-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine.
| Compound Name | (4aS,8aS)-6-[(2S)-hexan-2-yl]-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 146507365 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (4aS,8aS)-6-[(2S)-hexan-2-yl]-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine |
| SMILES | CCCC[C@H](C)N1CC[C@@H]2NCCO[C@H]2C1 |
| InChI | InChI=1S/C13H26N2O/c1-3-4-5-11(2)15-8-6-12-13(10-15)16-9-7-14-12/h11-14H,3-10H2,1-2H3/t11-,12-,13-/m0/s1 |
| InChIKey | BVFOICKOIMLZFB-AVGNSLFASA-N |
| XLogP | 1.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |