C17H14FN5O3 — CID 146507996
3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluoro-5-methoxy-4-pyridinyl)-6-hydroxybenzamide (PubChem CID 146507996) has the molecular formula C17H14FN5O3 and a molecular weight of 355.33 g/mol. Its IUPAC name is 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluoro-5-methoxy-4-pyridinyl)-6-hydroxybenzamide.
| Compound Name | 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluoro-5-methoxy-4-pyridinyl)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 146507996 |
| Molecular Formula | C17H14FN5O3 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-cyano-N-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-fluoro-5-methoxy-4-pyridinyl)-6-hydroxybenzamide |
| SMILES | COc1cnc(F)cc1-c1c(C#N)ccc(O)c1C(=O)NC1=NCCN1 |
| InChI | InChI=1S/C17H14FN5O3/c1-26-12-8-22-13(18)6-10(12)14-9(7-19)2-3-11(24)15(14)16(25)23-17-20-4-5-21-17/h2-3,6,8,24H,4-5H2,1H3,(H2,20,21,23,25) |
| InChIKey | VPLYUHQEWFODHI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|