C25H28ClN7O4S — CID 146509350
1-[[5-chloro-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-6-yl]amino]sulfanylpiperidin-4-ol (PubChem CID 146509350) has the molecular formula C25H28ClN7O4S and a molecular weight of 558.06 g/mol. Its IUPAC name is 1-[[5-chloro-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-6-yl]amino]sulfanylpiperidin-4-ol.
| Compound Name | 1-[[5-chloro-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-6-yl]amino]sulfanylpiperidin-4-ol |
|---|---|
| PubChem CID | 146509350 |
| Molecular Formula | C25H28ClN7O4S |
| Molecular Weight | 558.06 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 1-[[5-chloro-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-6-yl]amino]sulfanylpiperidin-4-ol |
| SMILES | CCOc1cccc(-c2nc3nc(Cl)c(NSN4CCC(O)CC4)nc3n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C25H28ClN7O4S/c1-4-37-19-10-5-7-16(27-19)24-30-23-25(33(24)20-17(35-2)8-6-9-18(20)36-3)29-22(21(26)28-23)31-38-32-13-11-15(34)12-14-32/h5-10,15,34H,4,11-14H2,1-3H3,(H,29,31) |
| InChIKey | PKERHQCJDUZVHS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.06 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|