C24H22N8O3S — CID 146509286
3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-N-pyrimidin-2-ylsulfanylimidazo[4,5-b]pyrazin-5-amine (PubChem CID 146509286) has the molecular formula C24H22N8O3S and a molecular weight of 502.56 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-N-pyrimidin-2-ylsulfanylimidazo[4,5-b]pyrazin-5-amine.
| Compound Name | 3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-N-pyrimidin-2-ylsulfanylimidazo[4,5-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 146509286 |
| Molecular Formula | C24H22N8O3S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-N-pyrimidin-2-ylsulfanylimidazo[4,5-b]pyrazin-5-amine |
| SMILES | CCOc1cccc(-c2nc3ncc(NSc4ncccn4)nc3n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C24H22N8O3S/c1-4-35-19-11-5-8-15(28-19)22-30-21-23(32(22)20-16(33-2)9-6-10-17(20)34-3)29-18(14-27-21)31-36-24-25-12-7-13-26-24/h5-14H,4H2,1-3H3,(H,29,31) |
| InChIKey | KLINPUWWQBEYRU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|