C24H27N7O4S — CID 146509343
N-[[2-(aminomethyl)oxiran-2-yl]methylsulfanyl]-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-5-amine (PubChem CID 146509343) has the molecular formula C24H27N7O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is N-[[2-(aminomethyl)oxiran-2-yl]methylsulfanyl]-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-5-amine.
| Compound Name | N-[[2-(aminomethyl)oxiran-2-yl]methylsulfanyl]-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 146509343 |
| Molecular Formula | C24H27N7O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | N-[[2-(aminomethyl)oxiran-2-yl]methylsulfanyl]-1-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyrazin-5-amine |
| SMILES | CCOc1cccc(-c2nc3nc(NSCC4(CN)CO4)cnc3n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C24H27N7O4S/c1-4-34-19-10-5-7-15(27-19)22-29-21-23(31(22)20-16(32-2)8-6-9-17(20)33-3)26-11-18(28-21)30-36-14-24(12-25)13-35-24/h5-11H,4,12-14,25H2,1-3H3,(H,28,30) |
| InChIKey | RKTOUMUYMKQWFS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|