C21H22N6O4S — CID 146509372
3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-5-(methylsulfanylamino)-7H-imidazo[4,5-b]pyrazin-6-one (PubChem CID 146509372) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-5-(methylsulfanylamino)-7H-imidazo[4,5-b]pyrazin-6-one.
| Compound Name | 3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-5-(methylsulfanylamino)-7H-imidazo[4,5-b]pyrazin-6-one |
|---|---|
| PubChem CID | 146509372 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)-2-(6-ethoxy-2-pyridinyl)-5-(methylsulfanylamino)-7H-imidazo[4,5-b]pyrazin-6-one |
| SMILES | CCOc1cccc(-c2nc3[nH]c(=O)c(NSC)nc3n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C21H22N6O4S/c1-5-31-15-11-6-8-12(22-15)19-23-17-20(24-18(26-32-4)21(28)25-17)27(19)16-13(29-2)9-7-10-14(16)30-3/h6-11H,5H2,1-4H3,(H,24,26)(H,25,28) |
| InChIKey | VAHBGRDRJRYBLW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|