C19H29N5O4S — CID 146509479
(E)-3-[4-[(2-methylcyclopentyl)amino]-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 146509479) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is (E)-3-[4-[(2-methylcyclopentyl)amino]-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2-methylcyclopentyl)amino]-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146509479 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (E)-3-[4-[(2-methylcyclopentyl)amino]-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | CC1CCCC1Nc1nc(NC2CCN(S(C)(=O)=O)CC2)ncc1/C=C/C(=O)O |
| InChI | InChI=1S/C19H29N5O4S/c1-13-4-3-5-16(13)22-18-14(6-7-17(25)26)12-20-19(23-18)21-15-8-10-24(11-9-15)29(2,27)28/h6-7,12-13,15-16H,3-5,8-11H2,1-2H3,(H,25,26)(H2,20,21,22,23)/b7-6+ |
| InChIKey | FTWIMTCNTMXNCA-VOTSOKGWSA-N |
| XLogP | 2.01 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|