C25H30N2O5 — CID 146510736
tert-butyl (6aS)-2-methoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 146510736) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is tert-butyl (6aS)-2-methoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl (6aS)-2-methoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 146510736 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | tert-butyl (6aS)-2-methoxy-11-oxo-3-phenylmethoxy-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | COc1cc2c(cc1OCc1ccccc1)N(C(=O)OC(C)(C)C)C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C25H30N2O5/c1-25(2,3)32-24(29)27-15-18-11-8-12-26(18)23(28)19-13-21(30-4)22(14-20(19)27)31-16-17-9-6-5-7-10-17/h5-7,9-10,13-14,18H,8,11-12,15-16H2,1-4H3/t18-/m0/s1 |
| InChIKey | TXKKCQZPRQUAPX-SFHVURJKSA-N |
| XLogP | 4.63 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |