About 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane
7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane (PubChem CID 146513647) has the molecular formula C13H15FN2O
and a molecular weight of 234.27 g/mol. Its IUPAC name is 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane.
Molecular Properties
| Compound Name | 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane |
| PubChem CID | 146513647 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane |
| SMILES | CN1CC2CC23CC(Oc2ccc(F)cn2)C13 |
| InChI | InChI=1S/C13H15FN2O/c1-16-7-8-4-13(8)5-10(12(13)16)17-11-3-2-9(14)6-15-11/h2-3,6,8,10,12H,4-5,7H2,1H3 |
| InChIKey | ACOPAKNLVHSLHI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
The IUPAC name of 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane (CID 146513647) is 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane.
What is the SMILES notation for 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
The canonical SMILES for 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane is CN1CC2CC23CC(Oc2ccc(F)cn2)C13.
What is the InChIKey of 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
The InChIKey is ACOPAKNLVHSLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O/c1-16-7-8-4-13(8)5-10(12(13)16)17-11-3-2-9(14)6-15-11/h2-3,6,8,10,12H,4-5,7H2,1H3.
What are the key properties of 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane has a molecular weight of 234.27 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5-fluoro-2-pyridinyl)oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane is sourced from PubChem (CID 146513647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).