C19H24N4O8 — CID 146514002
3-(2,6-dicyanatohexanoyloxy)propyl 2,6-dicyanatohexanoate (PubChem CID 146514002) has the molecular formula C19H24N4O8 and a molecular weight of 436.42 g/mol. Its IUPAC name is 3-(2,6-dicyanatohexanoyloxy)propyl 2,6-dicyanatohexanoate.
| Compound Name | 3-(2,6-dicyanatohexanoyloxy)propyl 2,6-dicyanatohexanoate |
|---|---|
| PubChem CID | 146514002 |
| Molecular Formula | C19H24N4O8 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-(2,6-dicyanatohexanoyloxy)propyl 2,6-dicyanatohexanoate |
| SMILES | N#COCCCCC(OC#N)C(=O)OCCCOC(=O)C(CCCCOC#N)OC#N |
| InChI | InChI=1S/C19H24N4O8/c20-12-26-8-3-1-6-16(30-14-22)18(24)28-10-5-11-29-19(25)17(31-15-23)7-2-4-9-27-13-21/h16-17H,1-11H2 |
| InChIKey | OIBFGEFPNSVEJG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 184.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|