C16H18N4O8 — CID 146514007
2-(2,5-dicyanatopentanoyloxy)ethyl 2,5-dicyanatopentanoate (PubChem CID 146514007) has the molecular formula C16H18N4O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is 2-(2,5-dicyanatopentanoyloxy)ethyl 2,5-dicyanatopentanoate.
| Compound Name | 2-(2,5-dicyanatopentanoyloxy)ethyl 2,5-dicyanatopentanoate |
|---|---|
| PubChem CID | 146514007 |
| Molecular Formula | C16H18N4O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-(2,5-dicyanatopentanoyloxy)ethyl 2,5-dicyanatopentanoate |
| SMILES | N#COCCCC(OC#N)C(=O)OCCOC(=O)C(CCCOC#N)OC#N |
| InChI | InChI=1S/C16H18N4O8/c17-9-23-5-1-3-13(27-11-19)15(21)25-7-8-26-16(22)14(28-12-20)4-2-6-24-10-18/h13-14H,1-8H2 |
| InChIKey | VSIMWSUIWXNAPY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 184.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|