About 2-cyanatoethyl 2-hydroxyprop-2-enoate
2-cyanatoethyl 2-hydroxyprop-2-enoate (PubChem CID 171814373) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is 2-cyanatoethyl 2-hydroxyprop-2-enoate.
Molecular Properties
| Compound Name | 2-cyanatoethyl 2-hydroxyprop-2-enoate |
| PubChem CID | 171814373 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2-cyanatoethyl 2-hydroxyprop-2-enoate |
| SMILES | C=C(O)C(=O)OCCOC#N |
| InChI | InChI=1S/C6H7NO4/c1-5(8)6(9)11-3-2-10-4-7/h8H,1-3H2 |
| InChIKey | NJEMOSSZTQWHMU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanatoethyl 2-hydroxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanatoethyl 2-hydroxyprop-2-enoate?
The IUPAC name of 2-cyanatoethyl 2-hydroxyprop-2-enoate (CID 171814373) is 2-cyanatoethyl 2-hydroxyprop-2-enoate.
What is the SMILES notation for 2-cyanatoethyl 2-hydroxyprop-2-enoate?
The canonical SMILES for 2-cyanatoethyl 2-hydroxyprop-2-enoate is C=C(O)C(=O)OCCOC#N.
What is the InChIKey of 2-cyanatoethyl 2-hydroxyprop-2-enoate?
The InChIKey is NJEMOSSZTQWHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4/c1-5(8)6(9)11-3-2-10-4-7/h8H,1-3H2.
What are the key properties of 2-cyanatoethyl 2-hydroxyprop-2-enoate?
2-cyanatoethyl 2-hydroxyprop-2-enoate has a molecular weight of 157.12 g/mol, XLogP of 0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanatoethyl 2-hydroxyprop-2-enoate is sourced from PubChem (CID 171814373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).