C22H16F4N6O — CID 146515545
[3-fluoro-5-(1,2,4-triazol-1-yl)phenyl]-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 146515545) has the molecular formula C22H16F4N6O and a molecular weight of 456.40 g/mol. Its IUPAC name is [3-fluoro-5-(1,2,4-triazol-1-yl)phenyl]-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | [3-fluoro-5-(1,2,4-triazol-1-yl)phenyl]-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 146515545 |
| Molecular Formula | C22H16F4N6O |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [3-fluoro-5-(1,2,4-triazol-1-yl)phenyl]-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CCN(C(=O)c1cc(F)cc(-n3cncn3)c1)C2 |
| InChI | InChI=1S/C22H16F4N6O/c1-30-21(12-6-17(24)20(26)18(25)7-12)16-2-3-31(9-19(16)29-30)22(33)13-4-14(23)8-15(5-13)32-11-27-10-28-32/h4-8,10-11H,2-3,9H2,1H3 |
| InChIKey | NGLLGHNVDJKYLX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|