C22H16F3N5O — CID 146515546
cinnolin-3-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 146515546) has the molecular formula C22H16F3N5O and a molecular weight of 423.40 g/mol. Its IUPAC name is cinnolin-3-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | cinnolin-3-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 146515546 |
| Molecular Formula | C22H16F3N5O |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | cinnolin-3-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CCN(C(=O)c1cc3ccccc3nn1)C2 |
| InChI | InChI=1S/C22H16F3N5O/c1-29-21(13-8-15(23)20(25)16(24)9-13)14-6-7-30(11-19(14)28-29)22(31)18-10-12-4-2-3-5-17(12)26-27-18/h2-5,8-10H,6-7,11H2,1H3 |
| InChIKey | PRTGYUCEXLZHNY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|