C16H16F3N3O — CID 146515975
N-[2-[[N-ethenyl-C-[(E)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]amino]phenyl]prop-2-enamide (PubChem CID 146515975) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is N-[2-[[N-ethenyl-C-[(E)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[N-ethenyl-C-[(E)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146515975 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[2-[[N-ethenyl-C-[(E)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]amino]phenyl]prop-2-enamide |
| SMILES | C=C/N=C(Nc1ccccc1NC(=O)C=C)\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O/c1-4-11(16(17,18)19)15(20-6-3)22-13-10-8-7-9-12(13)21-14(23)5-2/h4-10H,2-3H2,1H3,(H,20,22)(H,21,23)/b11-4+ |
| InChIKey | YRNJJZFKFMDTIE-NYYWCZLTSA-N |
| XLogP | 4.27 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|