C14H22O5S — CID 146517215
2-[[2-(methoxymethoxy)-3-(2-thiophen-3-ylethoxy)propoxy]methyl]oxirane (PubChem CID 146517215) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is 2-[[2-(methoxymethoxy)-3-(2-thiophen-3-ylethoxy)propoxy]methyl]oxirane.
| Compound Name | 2-[[2-(methoxymethoxy)-3-(2-thiophen-3-ylethoxy)propoxy]methyl]oxirane |
|---|---|
| PubChem CID | 146517215 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[[2-(methoxymethoxy)-3-(2-thiophen-3-ylethoxy)propoxy]methyl]oxirane |
| SMILES | COCOC(COCCc1ccsc1)COCC1CO1 |
| InChI | InChI=1S/C14H22O5S/c1-15-11-19-13(7-17-8-14-9-18-14)6-16-4-2-12-3-5-20-10-12/h3,5,10,13-14H,2,4,6-9,11H2,1H3 |
| InChIKey | LGUKLBYZRPXACF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|