C39H54FN3O3 — CID 146517224
7-[[6-ethyl-2-[(2S,4S)-4-fluoro-2-prop-2-enylhexoxy]-5-[4-(3-hydroxynaphthalen-1-yl)butyl]pyrimidin-4-yl]-propylamino]hept-1-en-3-one (PubChem CID 146517224) has the molecular formula C39H54FN3O3 and a molecular weight of 631.88 g/mol. Its IUPAC name is 7-[[6-ethyl-2-[(2S,4S)-4-fluoro-2-prop-2-enylhexoxy]-5-[4-(3-hydroxynaphthalen-1-yl)butyl]pyrimidin-4-yl]-propylamino]hept-1-en-3-one.
| Compound Name | 7-[[6-ethyl-2-[(2S,4S)-4-fluoro-2-prop-2-enylhexoxy]-5-[4-(3-hydroxynaphthalen-1-yl)butyl]pyrimidin-4-yl]-propylamino]hept-1-en-3-one |
|---|---|
| PubChem CID | 146517224 |
| Molecular Formula | C39H54FN3O3 |
| Molecular Weight | 631.88 g/mol |
| Exact Mass | 631.41 |
| IUPAC Name | 7-[[6-ethyl-2-[(2S,4S)-4-fluoro-2-prop-2-enylhexoxy]-5-[4-(3-hydroxynaphthalen-1-yl)butyl]pyrimidin-4-yl]-propylamino]hept-1-en-3-one |
| SMILES | C=CC[C@H](COc1nc(CC)c(CCCCc2cc(O)cc3ccccc23)c(N(CCC)CCCCC(=O)C=C)n1)C[C@@H](F)CC |
| InChI | InChI=1S/C39H54FN3O3/c1-6-17-29(25-32(40)8-3)28-46-39-41-37(10-5)36(38(42-39)43(23-7-2)24-16-15-20-33(44)9-4)22-14-12-19-31-27-34(45)26-30-18-11-13-21-35(30)31/h6,9,11,13,18,21,26-27,29,32,45H,1,4,7-8,10,12,14-17,19-20,22-25,28H2,2-3,5H3/t29-,32-/m0/s1 |
| InChIKey | HMXOGDIWZZQMPJ-NYDCQLBNSA-N |
| XLogP | 9.31 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.88 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|