C11H21N — CID 146518077
(2R)-1-tert-butyl-2-propan-2-yl-2,5-dihydropyrrole (PubChem CID 146518077) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2R)-1-tert-butyl-2-propan-2-yl-2,5-dihydropyrrole.
| Compound Name | (2R)-1-tert-butyl-2-propan-2-yl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 146518077 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2R)-1-tert-butyl-2-propan-2-yl-2,5-dihydropyrrole |
| SMILES | CC(C)[C@@H]1C=CCN1C(C)(C)C |
| InChI | InChI=1S/C11H21N/c1-9(2)10-7-6-8-12(10)11(3,4)5/h6-7,9-10H,8H2,1-5H3/t10-/m0/s1 |
| InChIKey | FVSIAJMKYFJIBV-JTQLQIEISA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|