C17H16N2O4 — CID 146523465
2-(3,4-dimethoxyphenyl)-8-methoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 146523465) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-8-methoxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-8-methoxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 146523465 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-8-methoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | COc1ccn2c(=O)cc(-c3ccc(OC)c(OC)c3)nc2c1 |
| InChI | InChI=1S/C17H16N2O4/c1-21-12-6-7-19-16(9-12)18-13(10-17(19)20)11-4-5-14(22-2)15(8-11)23-3/h4-10H,1-3H3 |
| InChIKey | KDDQCFPIMIUIJY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |