C19H27F3N6OP+ — CID 146524933
tripyrrolidin-1-yl-[4-(trifluoromethyl)benzotriazol-1-yl]oxyphosphanium (PubChem CID 146524933) has the molecular formula C19H27F3N6OP+ and a molecular weight of 443.43 g/mol. Its IUPAC name is tripyrrolidin-1-yl-[4-(trifluoromethyl)benzotriazol-1-yl]oxyphosphanium.
| Compound Name | tripyrrolidin-1-yl-[4-(trifluoromethyl)benzotriazol-1-yl]oxyphosphanium |
|---|---|
| PubChem CID | 146524933 |
| Molecular Formula | C19H27F3N6OP+ |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | tripyrrolidin-1-yl-[4-(trifluoromethyl)benzotriazol-1-yl]oxyphosphanium |
| SMILES | FC(F)(F)c1cccc2c1nnn2O[P+](N1CCCC1)(N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C19H27F3N6OP/c20-19(21,22)16-8-7-9-17-18(16)23-24-28(17)29-30(25-10-1-2-11-25,26-12-3-4-13-26)27-14-5-6-15-27/h7-9H,1-6,10-15H2/q+1 |
| InChIKey | AQDAMZHZZUNMJK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|