C24H19FN2O4 — CID 146524981
1-[2-(4-fluoro-2,6-dimethylphenoxy)-5-nitrophenyl]-3-methylquinolin-4-one (PubChem CID 146524981) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is 1-[2-(4-fluoro-2,6-dimethylphenoxy)-5-nitrophenyl]-3-methylquinolin-4-one.
| Compound Name | 1-[2-(4-fluoro-2,6-dimethylphenoxy)-5-nitrophenyl]-3-methylquinolin-4-one |
|---|---|
| PubChem CID | 146524981 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-[2-(4-fluoro-2,6-dimethylphenoxy)-5-nitrophenyl]-3-methylquinolin-4-one |
| SMILES | Cc1cc(F)cc(C)c1Oc1ccc([N+](=O)[O-])cc1-n1cc(C)c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H19FN2O4/c1-14-10-17(25)11-15(2)24(14)31-22-9-8-18(27(29)30)12-21(22)26-13-16(3)23(28)19-6-4-5-7-20(19)26/h4-13H,1-3H3 |
| InChIKey | ZPUUSUDVMGTPQE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|