C25H25N3O3 — CID 146525396
6-[4-[2-[(2-methoxyethylamino)methyl]phenyl]phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid (PubChem CID 146525396) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 6-[4-[2-[(2-methoxyethylamino)methyl]phenyl]phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 6-[4-[2-[(2-methoxyethylamino)methyl]phenyl]phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146525396 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 6-[4-[2-[(2-methoxyethylamino)methyl]phenyl]phenyl]-2-methyl-1H-benzimidazole-4-carboxylic acid |
| SMILES | COCCNCc1ccccc1-c1ccc(-c2cc(C(=O)O)c3nc(C)[nH]c3c2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-16-27-23-14-20(13-22(25(29)30)24(23)28-16)17-7-9-18(10-8-17)21-6-4-3-5-19(21)15-26-11-12-31-2/h3-10,13-14,26H,11-12,15H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | VKJQWHZMLXQNPA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|