C26H27F4N5O5S — CID 146525547
[[(1S,2S,5S)-2-[5-fluoro-2-hydroxy-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-methylamino]methyl formate (PubChem CID 146525547) has the molecular formula C26H27F4N5O5S and a molecular weight of 597.59 g/mol. Its IUPAC name is [[(1S,2S,5S)-2-[5-fluoro-2-hydroxy-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-methylamino]methyl formate.
| Compound Name | [[(1S,2S,5S)-2-[5-fluoro-2-hydroxy-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-methylamino]methyl formate |
|---|---|
| PubChem CID | 146525547 |
| Molecular Formula | C26H27F4N5O5S |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | [[(1S,2S,5S)-2-[5-fluoro-2-hydroxy-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-methylamino]methyl formate |
| SMILES | CN(COC=O)[C@H]1C[C@@H](c2cccc(C(F)(F)F)c2)CC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2ccncn2)cc1O |
| InChI | InChI=1S/C26H27F4N5O5S/c1-35(14-40-15-36)22-10-17(16-3-2-4-18(9-16)26(28,29)30)5-6-20(22)33-21-11-19(27)24(12-23(21)37)41(38,39)34-25-7-8-31-13-32-25/h2-4,7-9,11-13,15,17,20,22,33,37H,5-6,10,14H2,1H3,(H,31,32,34)/t17-,20-,22-/m0/s1 |
| InChIKey | BJHJIRLZKYMFOO-XJABCFGWSA-N |
| XLogP | 4.32 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|