C27H29ClF4N4O4S — CID 159363256
(1S,2S,4S)-2-N-[2-chloro-5-fluoro-4-(pyrimidin-4-ylmethylsulfonyl)phenyl]-1-N,1-N-dimethyl-4-[3-(trifluoromethyl)phenyl]cyclohexane-1,2-diamine;formic acid (PubChem CID 159363256) has the molecular formula C27H29ClF4N4O4S and a molecular weight of 617.07 g/mol. Its IUPAC name is (1S,2S,4S)-2-N-[2-chloro-5-fluoro-4-(pyrimidin-4-ylmethylsulfonyl)phenyl]-1-N,1-N-dimethyl-4-[3-(trifluoromethyl)phenyl]cyclohexane-1,2-diamine;formic acid.
| Compound Name | (1S,2S,4S)-2-N-[2-chloro-5-fluoro-4-(pyrimidin-4-ylmethylsulfonyl)phenyl]-1-N,1-N-dimethyl-4-[3-(trifluoromethyl)phenyl]cyclohexane-1,2-diamine;formic acid |
|---|---|
| PubChem CID | 159363256 |
| Molecular Formula | C27H29ClF4N4O4S |
| Molecular Weight | 617.07 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | (1S,2S,4S)-2-N-[2-chloro-5-fluoro-4-(pyrimidin-4-ylmethylsulfonyl)phenyl]-1-N,1-N-dimethyl-4-[3-(trifluoromethyl)phenyl]cyclohexane-1,2-diamine;formic acid |
| SMILES | CN(C)[C@H]1CC[C@H](c2cccc(C(F)(F)F)c2)C[C@@H]1Nc1cc(F)c(S(=O)(=O)Cc2ccncn2)cc1Cl.O=CO |
| InChI | InChI=1S/C26H27ClF4N4O2S.CH2O2/c1-35(2)24-7-6-17(16-4-3-5-18(10-16)26(29,30)31)11-23(24)34-22-13-21(28)25(12-20(22)27)38(36,37)14-19-8-9-32-15-33-19;2-1-3/h3-5,8-10,12-13,15,17,23-24,34H,6-7,11,14H2,1-2H3;1H,(H,2,3)/t17-,23-,24-;/m0./s1 |
| InChIKey | LIULQSKGCQLADD-XDNMHHATSA-N |
| XLogP | 5.64 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.07 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|