C18H18F3N5O4S — CID 146525666
2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 146525666) has the molecular formula C18H18F3N5O4S and a molecular weight of 457.43 g/mol. Its IUPAC name is 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146525666 |
| Molecular Formula | C18H18F3N5O4S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)c2cc(C(F)(F)F)cnc2N2CCC3OCCC32)ccn1 |
| InChI | InChI=1S/C18H18F3N5O4S/c19-18(20,21)10-7-12(16(24-9-10)26-5-2-14-13(26)3-6-30-14)17(27)25-11-1-4-23-15(8-11)31(22,28)29/h1,4,7-9,13-14H,2-3,5-6H2,(H2,22,28,29)(H,23,25,27) |
| InChIKey | VDAQBBPZILCXLB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |