C17H18ClF2N5O3S — CID 146525797
6-chloro-2-(4,4-difluoroazepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide (PubChem CID 146525797) has the molecular formula C17H18ClF2N5O3S and a molecular weight of 445.88 g/mol. Its IUPAC name is 6-chloro-2-(4,4-difluoroazepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-2-(4,4-difluoroazepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146525797 |
| Molecular Formula | C17H18ClF2N5O3S |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 6-chloro-2-(4,4-difluoroazepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)c2ccc(Cl)nc2N2CCCC(F)(F)CC2)ccn1 |
| InChI | InChI=1S/C17H18ClF2N5O3S/c18-13-3-2-12(15(24-13)25-8-1-5-17(19,20)6-9-25)16(26)23-11-4-7-22-14(10-11)29(21,27)28/h2-4,7,10H,1,5-6,8-9H2,(H2,21,27,28)(H,22,23,26) |
| InChIKey | WJTFDOWBRLNSDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|