C18H20F3N5O3S — CID 146525799
2-(azepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 146525799) has the molecular formula C18H20F3N5O3S and a molecular weight of 443.45 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(azepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146525799 |
| Molecular Formula | C18H20F3N5O3S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-(azepan-1-yl)-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)c2cc(C(F)(F)F)cnc2N2CCCCCC2)ccn1 |
| InChI | InChI=1S/C18H20F3N5O3S/c19-18(20,21)12-9-14(16(24-11-12)26-7-3-1-2-4-8-26)17(27)25-13-5-6-23-15(10-13)30(22,28)29/h5-6,9-11H,1-4,7-8H2,(H2,22,28,29)(H,23,25,27) |
| InChIKey | PRSXLXDKZQDIFN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |