C24H44IN9O5 — CID 146526657
2-[[5-[[(2S)-1-amino-2-[(iodomethylamino)methyl]-3-[2-(2,2,3-triaminopropylamino)ethylamino]propan-2-yl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 146526657) has the molecular formula C24H44IN9O5 and a molecular weight of 665.58 g/mol. Its IUPAC name is 2-[[5-[[(2S)-1-amino-2-[(iodomethylamino)methyl]-3-[2-(2,2,3-triaminopropylamino)ethylamino]propan-2-yl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[5-[[(2S)-1-amino-2-[(iodomethylamino)methyl]-3-[2-(2,2,3-triaminopropylamino)ethylamino]propan-2-yl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 146526657 |
| Molecular Formula | C24H44IN9O5 |
| Molecular Weight | 665.58 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 2-[[5-[[(2S)-1-amino-2-[(iodomethylamino)methyl]-3-[2-(2,2,3-triaminopropylamino)ethylamino]propan-2-yl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NCC(N)(N)CNCCNC[C@@](CN)(CNCI)NC(=O)CCCC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H44IN9O5/c25-16-32-14-23(11-26,13-30-8-9-31-15-24(28,29)12-27)34-21(37)3-1-2-20(36)33-19(22(38)39)10-17-4-6-18(35)7-5-17/h4-7,19,30-32,35H,1-3,8-16,26-29H2,(H,33,36)(H,34,37)(H,38,39)/t19?,23-/m0/s1 |
| InChIKey | LKNUGXNEXVWLSW-BVHINDKJSA-N |
| XLogP | -2.78 |
| TPSA | 255.90 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.58 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|