C23H18F3N5O3S — CID 146528089
1-phenyl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfonamide (PubChem CID 146528089) has the molecular formula C23H18F3N5O3S and a molecular weight of 501.49 g/mol. Its IUPAC name is 1-phenyl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfonamide.
| Compound Name | 1-phenyl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 146528089 |
| Molecular Formula | C23H18F3N5O3S |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 1-phenyl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfonamide |
| SMILES | CNc1nccc(-c2cccnc2Oc2cc(F)c(NS(=O)(=O)Cc3ccccc3)c(F)c2F)n1 |
| InChI | InChI=1S/C23H18F3N5O3S/c1-27-23-29-11-9-17(30-23)15-8-5-10-28-22(15)34-18-12-16(24)21(20(26)19(18)25)31-35(32,33)13-14-6-3-2-4-7-14/h2-12,31H,13H2,1H3,(H,27,29,30) |
| InChIKey | LLLRHXHEUYSUGU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|